C12H17BrClFN2 — CID 106765455
[1-(4-bromo-3-chloro-2-fluorophenyl)-2-ethylbutyl]hydrazine (PubChem CID 106765455) has the molecular formula C12H17BrClFN2 and a molecular weight of 323.64 g/mol. Its IUPAC name is [1-(4-bromo-3-chloro-2-fluorophenyl)-2-ethylbutyl]hydrazine.
| Compound Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2-ethylbutyl]hydrazine |
|---|---|
| PubChem CID | 106765455 |
| Molecular Formula | C12H17BrClFN2 |
| Molecular Weight | 323.64 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2-ethylbutyl]hydrazine |
| SMILES | CCC(CC)C(NN)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C12H17BrClFN2/c1-3-7(4-2)12(17-16)8-5-6-9(13)10(14)11(8)15/h5-7,12,17H,3-4,16H2,1-2H3 |
| InChIKey | UCASINMMMMQQOG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|