C15H22BrClFNS — CID 106762580
N-[1-(4-bromo-3-chloro-2-fluorophenyl)-2-(2-methylpropylsulfanyl)ethyl]propan-1-amine (PubChem CID 106762580) has the molecular formula C15H22BrClFNS and a molecular weight of 382.77 g/mol. Its IUPAC name is N-[1-(4-bromo-3-chloro-2-fluorophenyl)-2-(2-methylpropylsulfanyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-bromo-3-chloro-2-fluorophenyl)-2-(2-methylpropylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106762580 |
| Molecular Formula | C15H22BrClFNS |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-[1-(4-bromo-3-chloro-2-fluorophenyl)-2-(2-methylpropylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSCC(C)C)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C15H22BrClFNS/c1-4-7-19-13(9-20-8-10(2)3)11-5-6-12(16)14(17)15(11)18/h5-6,10,13,19H,4,7-9H2,1-3H3 |
| InChIKey | ZFXHTKPPZMUXMP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|