C14H13Br2ClFNS — CID 106764663
N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromothiophen-3-yl)methyl]propan-1-amine (PubChem CID 106764663) has the molecular formula C14H13Br2ClFNS and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromothiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromothiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106764663 |
| Molecular Formula | C14H13Br2ClFNS |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 438.88 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromothiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(Br)c1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C14H13Br2ClFNS/c1-2-5-19-14(8-6-11(16)20-7-8)9-3-4-10(15)12(17)13(9)18/h3-4,6-7,14,19H,2,5H2,1H3 |
| InChIKey | USIPCPGJLSOVBO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|