C16H15BrClFIN — CID 106764355
N-[(4-bromo-3-chloro-2-fluorophenyl)-(3-iodophenyl)methyl]propan-1-amine (PubChem CID 106764355) has the molecular formula C16H15BrClFIN and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(3-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(3-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106764355 |
| Molecular Formula | C16H15BrClFIN |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 480.91 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(3-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(I)c1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C16H15BrClFIN/c1-2-8-21-16(10-4-3-5-11(20)9-10)12-6-7-13(17)14(18)15(12)19/h3-7,9,16,21H,2,8H2,1H3 |
| InChIKey | WJZBUHKNEWMGHC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|