C17H19FIN — CID 115852372
N-[(4-fluoro-2-methylphenyl)-(3-iodophenyl)methyl]propan-1-amine (PubChem CID 115852372) has the molecular formula C17H19FIN and a molecular weight of 383.25 g/mol. Its IUPAC name is N-[(4-fluoro-2-methylphenyl)-(3-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[(4-fluoro-2-methylphenyl)-(3-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115852372 |
| Molecular Formula | C17H19FIN |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[(4-fluoro-2-methylphenyl)-(3-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(I)c1)c1ccc(F)cc1C |
| InChI | InChI=1S/C17H19FIN/c1-3-9-20-17(13-5-4-6-15(19)11-13)16-8-7-14(18)10-12(16)2/h4-8,10-11,17,20H,3,9H2,1-2H3 |
| InChIKey | WOVXUTFRZNVDSI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|