C10H13N3 — CID 131014593
2-[(1R)-1,3-diaminopropyl]benzonitrile (PubChem CID 131014593) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-[(1R)-1,3-diaminopropyl]benzonitrile.
| Compound Name | 2-[(1R)-1,3-diaminopropyl]benzonitrile |
|---|---|
| PubChem CID | 131014593 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-[(1R)-1,3-diaminopropyl]benzonitrile |
| SMILES | N#Cc1ccccc1[C@H](N)CCN |
| InChI | InChI=1S/C10H13N3/c11-6-5-10(13)9-4-2-1-3-8(9)7-12/h1-4,10H,5-6,11,13H2/t10-/m1/s1 |
| InChIKey | TZFVUUUDYVPBRA-SNVBAGLBSA-N |
| XLogP | 0.91 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |