C12H13FN2O3 — CID 170830081
N-[3-(5-cyano-2-fluorophenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830081) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-[3-(5-cyano-2-fluorophenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(5-cyano-2-fluorophenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830081 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-[3-(5-cyano-2-fluorophenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(C#N)ccc1F |
| InChI | InChI=1S/C12H13FN2O3/c1-7(16)15-6-11(17)12(18)9-4-8(5-14)2-3-10(9)13/h2-4,11-12,17-18H,6H2,1H3,(H,15,16) |
| InChIKey | JLEZFDACXFJDFW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |