C9H11Cl2N — CID 54345845
4-(dichloromethyl)-2,3-dimethylaniline (PubChem CID 54345845) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 4-(dichloromethyl)-2,3-dimethylaniline.
| Compound Name | 4-(dichloromethyl)-2,3-dimethylaniline |
|---|---|
| PubChem CID | 54345845 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 4-(dichloromethyl)-2,3-dimethylaniline |
| SMILES | Cc1c(N)ccc(C(Cl)Cl)c1C |
| InChI | InChI=1S/C9H11Cl2N/c1-5-6(2)8(12)4-3-7(5)9(10)11/h3-4,9H,12H2,1-2H3 |
| InChIKey | UCGOQVWVIZDANO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|