C10H13BrFNO2 — CID 171860020
1-(3-amino-5-fluoro-2-methylphenyl)-3-bromopropane-1,2-diol (PubChem CID 171860020) has the molecular formula C10H13BrFNO2 and a molecular weight of 278.12 g/mol. Its IUPAC name is 1-(3-amino-5-fluoro-2-methylphenyl)-3-bromopropane-1,2-diol.
| Compound Name | 1-(3-amino-5-fluoro-2-methylphenyl)-3-bromopropane-1,2-diol |
|---|---|
| PubChem CID | 171860020 |
| Molecular Formula | C10H13BrFNO2 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 1-(3-amino-5-fluoro-2-methylphenyl)-3-bromopropane-1,2-diol |
| SMILES | Cc1c(N)cc(F)cc1C(O)C(O)CBr |
| InChI | InChI=1S/C10H13BrFNO2/c1-5-7(10(15)9(14)4-11)2-6(12)3-8(5)13/h2-3,9-10,14-15H,4,13H2,1H3 |
| InChIKey | ACPAYQZGOLIQFQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|