C9H13FN2O3 — CID 170817825
1-(2,3-diamino-5-fluorophenyl)propane-1,2,3-triol (PubChem CID 170817825) has the molecular formula C9H13FN2O3 and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-(2,3-diamino-5-fluorophenyl)propane-1,2,3-triol.
| Compound Name | 1-(2,3-diamino-5-fluorophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817825 |
| Molecular Formula | C9H13FN2O3 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2,3-diamino-5-fluorophenyl)propane-1,2,3-triol |
| SMILES | Nc1cc(F)cc(C(O)C(O)CO)c1N |
| InChI | InChI=1S/C9H13FN2O3/c10-4-1-5(8(12)6(11)2-4)9(15)7(14)3-13/h1-2,7,9,13-15H,3,11-12H2 |
| InChIKey | LCQLIEWFDQVRNL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|