C10H14FNO3 — CID 170817867
1-[2-(aminomethyl)-4-fluorophenyl]propane-1,2,3-triol (PubChem CID 170817867) has the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-4-fluorophenyl]propane-1,2,3-triol.
| Compound Name | 1-[2-(aminomethyl)-4-fluorophenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817867 |
| Molecular Formula | C10H14FNO3 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-[2-(aminomethyl)-4-fluorophenyl]propane-1,2,3-triol |
| SMILES | NCc1cc(F)ccc1C(O)C(O)CO |
| InChI | InChI=1S/C10H14FNO3/c11-7-1-2-8(6(3-7)4-12)10(15)9(14)5-13/h1-3,9-10,13-15H,4-5,12H2 |
| InChIKey | GULQERZBPWYEIY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |