About 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid
3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid (PubChem CID 170823976) has the molecular formula C10H12FNO4
and a molecular weight of 229.21 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid.
Analyze 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid (CID 170823976) is 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid is NCc1cc(F)ccc1C(O)C(O)C(=O)O.
What is the InChIKey of 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid?
The InChIKey is PVKOGHXSPRYOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO4/c11-6-1-2-7(5(3-6)4-12)8(13)9(14)10(15)16/h1-3,8-9,13-14H,4,12H2,(H,15,16).
What are the key properties of 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid?
3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid has a molecular weight of 229.21 g/mol, XLogP of -0.24, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(aminomethyl)-4-fluorophenyl]-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170823976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).