C8H11NO4 — CID 134064056
(2,6-dimethoxy-3-pyridinyl)methanediol (PubChem CID 134064056) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is (2,6-dimethoxy-3-pyridinyl)methanediol.
| Compound Name | (2,6-dimethoxy-3-pyridinyl)methanediol |
|---|---|
| PubChem CID | 134064056 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (2,6-dimethoxy-3-pyridinyl)methanediol |
| SMILES | COc1ccc(C(O)O)c(OC)n1 |
| InChI | InChI=1S/C8H11NO4/c1-12-6-4-3-5(8(10)11)7(9-6)13-2/h3-4,8,10-11H,1-2H3 |
| InChIKey | YBWLFGKYQIGTTH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|