C10H12N2O4 — CID 171870701
3-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870701) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870701 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | COc1ccc(C(O)C(O)C#N)c(OC)n1 |
| InChI | InChI=1S/C10H12N2O4/c1-15-8-4-3-6(10(12-8)16-2)9(14)7(13)5-11/h3-4,7,9,13-14H,1-2H3 |
| InChIKey | NVFGFUQCXBAHEX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|