C10H9F3N2O3 — CID 171871161
2,3-dihydroxy-3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]propanenitrile (PubChem CID 171871161) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]propanenitrile.
| Compound Name | 2,3-dihydroxy-3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]propanenitrile |
|---|---|
| PubChem CID | 171871161 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2,3-dihydroxy-3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]propanenitrile |
| SMILES | COc1ncc(C(F)(F)F)cc1C(O)C(O)C#N |
| InChI | InChI=1S/C10H9F3N2O3/c1-18-9-6(8(17)7(16)3-14)2-5(4-15-9)10(11,12)13/h2,4,7-8,16-17H,1H3 |
| InChIKey | QIGKKMWDRMNFBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|