C9H6ClF3N2O2 — CID 171870889
3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroxypropanenitrile (PubChem CID 171870889) has the molecular formula C9H6ClF3N2O2 and a molecular weight of 266.61 g/mol. Its IUPAC name is 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroxypropanenitrile.
| Compound Name | 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870889 |
| Molecular Formula | C9H6ClF3N2O2 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H6ClF3N2O2/c10-5-1-4(9(11,12)13)3-15-7(5)8(17)6(16)2-14/h1,3,6,8,16-17H |
| InChIKey | OEHOCYNHURXYLN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|