C14H11ClF3NO2 — CID 4522761
[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(4-methoxyphenyl)methanol (PubChem CID 4522761) has the molecular formula C14H11ClF3NO2 and a molecular weight of 317.69 g/mol. Its IUPAC name is [3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(4-methoxyphenyl)methanol.
| Compound Name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 4522761 |
| Molecular Formula | C14H11ClF3NO2 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H11ClF3NO2/c1-21-10-4-2-8(3-5-10)13(20)12-11(15)6-9(7-19-12)14(16,17)18/h2-7,13,20H,1H3 |
| InChIKey | ROAKEQGHGCPMBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |