C16H12F6O2 — CID 3625167
[3,5-bis(trifluoromethyl)phenyl]-(4-methoxyphenyl)methanol (PubChem CID 3625167) has the molecular formula C16H12F6O2 and a molecular weight of 350.26 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(4-methoxyphenyl)methanol.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 3625167 |
| Molecular Formula | C16H12F6O2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H12F6O2/c1-24-13-4-2-9(3-5-13)14(23)10-6-11(15(17,18)19)8-12(7-10)16(20,21)22/h2-8,14,23H,1H3 |
| InChIKey | FGCKLQKHIHPBSC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |