C11H13ClF3NO — CID 63201271
3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pentan-2-ol (PubChem CID 63201271) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pentan-2-ol.
| Compound Name | 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pentan-2-ol |
|---|---|
| PubChem CID | 63201271 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pentan-2-ol |
| SMILES | CCC(c1ncc(C(F)(F)F)cc1Cl)C(C)O |
| InChI | InChI=1S/C11H13ClF3NO/c1-3-8(6(2)17)10-9(12)4-7(5-16-10)11(13,14)15/h4-6,8,17H,3H2,1-2H3 |
| InChIKey | KPMLETKIDOSVBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |