C10H13Cl2F3N2 — CID 66798194
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]butan-1-amine;hydrochloride (PubChem CID 66798194) has the molecular formula C10H13Cl2F3N2 and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]butan-1-amine;hydrochloride.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66798194 |
| Molecular Formula | C10H13Cl2F3N2 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]butan-1-amine;hydrochloride |
| SMILES | CCC(CN)c1ncc(C(F)(F)F)cc1Cl.Cl |
| InChI | InChI=1S/C10H12ClF3N2.ClH/c1-2-6(4-15)9-8(11)3-7(5-16-9)10(12,13)14;/h3,5-6H,2,4,15H2,1H3;1H |
| InChIKey | GHAHYLPKOLWBSB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |