C14H11Cl2F3N2 — CID 170875466
2-(4-chlorophenyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine (PubChem CID 170875466) has the molecular formula C14H11Cl2F3N2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 170875466 |
| Molecular Formula | C14H11Cl2F3N2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine |
| SMILES | NCC(c1ccc(Cl)cc1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F3N2/c15-10-3-1-8(2-4-10)11(6-20)13-12(16)5-9(7-21-13)14(17,18)19/h1-5,7,11H,6,20H2 |
| InChIKey | CCGKUMPYSXHSJR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |