C14H13Cl2N — CID 13110442
2,2-bis(4-chlorophenyl)ethanamine (PubChem CID 13110442) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)ethanamine.
| Compound Name | 2,2-bis(4-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 13110442 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)ethanamine |
| SMILES | NCC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13Cl2N/c15-12-5-1-10(2-6-12)14(9-17)11-3-7-13(16)8-4-11/h1-8,14H,9,17H2 |
| InChIKey | KDDFOSJQPZKUJZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |