C14H15ClN2 — CID 170894784
1-[4-(4-chlorophenyl)phenyl]ethane-1,2-diamine (PubChem CID 170894784) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)phenyl]ethane-1,2-diamine.
| Compound Name | 1-[4-(4-chlorophenyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894784 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-[4-(4-chlorophenyl)phenyl]ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H15ClN2/c15-13-7-5-11(6-8-13)10-1-3-12(4-2-10)14(17)9-16/h1-8,14H,9,16-17H2 |
| InChIKey | IGMQKWSGUQILJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |