C12H14N2S — CID 156902220
1-(4-thiophen-3-ylphenyl)ethane-1,2-diamine (PubChem CID 156902220) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 1-(4-thiophen-3-ylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-thiophen-3-ylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 156902220 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-(4-thiophen-3-ylphenyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C12H14N2S/c13-7-12(14)10-3-1-9(2-4-10)11-5-6-15-8-11/h1-6,8,12H,7,13-14H2 |
| InChIKey | SMJXIPNQEUWBLJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |