C8H6Cl2F3N3 — CID 23078241
2-amino-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile;hydrochloride (PubChem CID 23078241) has the molecular formula C8H6Cl2F3N3 and a molecular weight of 272.06 g/mol. Its IUPAC name is 2-amino-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile;hydrochloride.
| Compound Name | 2-amino-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile;hydrochloride |
|---|---|
| PubChem CID | 23078241 |
| Molecular Formula | C8H6Cl2F3N3 |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2-amino-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile;hydrochloride |
| SMILES | Cl.N#CC(N)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H5ClF3N3.ClH/c9-5-1-4(8(10,11)12)3-15-7(5)6(14)2-13;/h1,3,6H,14H2;1H |
| InChIKey | YRCYSWZNRKEQJE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |