C12H6ClF3N2S — CID 4553007
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetonitrile (PubChem CID 4553007) has the molecular formula C12H6ClF3N2S and a molecular weight of 302.71 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetonitrile.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetonitrile |
|---|---|
| PubChem CID | 4553007 |
| Molecular Formula | C12H6ClF3N2S |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetonitrile |
| SMILES | N#CC(c1cccs1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H6ClF3N2S/c13-9-4-7(12(14,15)16)6-18-11(9)8(5-17)10-2-1-3-19-10/h1-4,6,8H |
| InChIKey | MRGVWGYPMQITRX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |