C12H7ClF3N3OS — CID 51086328
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(cyanomethylsulfanyl)-3-oxobutanenitrile (PubChem CID 51086328) has the molecular formula C12H7ClF3N3OS and a molecular weight of 333.72 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(cyanomethylsulfanyl)-3-oxobutanenitrile.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(cyanomethylsulfanyl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 51086328 |
| Molecular Formula | C12H7ClF3N3OS |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(cyanomethylsulfanyl)-3-oxobutanenitrile |
| SMILES | N#CCSCC(=O)C(C#N)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H7ClF3N3OS/c13-9-3-7(12(14,15)16)5-19-11(9)8(4-18)10(20)6-21-2-1-17/h3,5,8H,2,6H2 |
| InChIKey | HGJCWKSRDTVZKC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|