C15H21NO — CID 114200544
1-(1H-indol-4-yl)-2,4-dimethylpentan-1-ol (PubChem CID 114200544) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-2,4-dimethylpentan-1-ol.
| Compound Name | 1-(1H-indol-4-yl)-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114200544 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(1H-indol-4-yl)-2,4-dimethylpentan-1-ol |
| SMILES | CC(C)CC(C)C(O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C15H21NO/c1-10(2)9-11(3)15(17)13-5-4-6-14-12(13)7-8-16-14/h4-8,10-11,15-17H,9H2,1-3H3 |
| InChIKey | FATTYSBYDYZZFF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |