About 4-butan-2-yl-1H-indole;ethane
4-butan-2-yl-1H-indole;ethane (PubChem CID 143835108) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-butan-2-yl-1H-indole;ethane.
Molecular Properties
| Compound Name | 4-butan-2-yl-1H-indole;ethane |
| PubChem CID | 143835108 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-butan-2-yl-1H-indole;ethane |
| SMILES | CC.CCC(C)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C12H15N.C2H6/c1-3-9(2)10-5-4-6-12-11(10)7-8-13-12;1-2/h4-9,13H,3H2,1-2H3;1-2H3 |
| InChIKey | DWMYBRRCBKYMIU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-butan-2-yl-1H-indole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-1H-indole;ethane?
The IUPAC name of 4-butan-2-yl-1H-indole;ethane (CID 143835108) is 4-butan-2-yl-1H-indole;ethane.
What is the SMILES notation for 4-butan-2-yl-1H-indole;ethane?
The canonical SMILES for 4-butan-2-yl-1H-indole;ethane is CC.CCC(C)c1cccc2[nH]ccc12.
What is the InChIKey of 4-butan-2-yl-1H-indole;ethane?
The InChIKey is DWMYBRRCBKYMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C2H6/c1-3-9(2)10-5-4-6-12-11(10)7-8-13-12;1-2/h4-9,13H,3H2,1-2H3;1-2H3.
What are the key properties of 4-butan-2-yl-1H-indole;ethane?
4-butan-2-yl-1H-indole;ethane has a molecular weight of 203.33 g/mol, XLogP of 4.71, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-1H-indole;ethane is sourced from PubChem (CID 143835108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).