C22H35N — CID 59318269
N-[2,6-di(propan-2-yl)phenyl]-3,3,6-trimethylhept-5-en-2-imine (PubChem CID 59318269) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-3,3,6-trimethylhept-5-en-2-imine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-3,3,6-trimethylhept-5-en-2-imine |
|---|---|
| PubChem CID | 59318269 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-3,3,6-trimethylhept-5-en-2-imine |
| SMILES | CC(C)=CCC(C)(C)/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C22H35N/c1-15(2)13-14-22(8,9)18(7)23-21-19(16(3)4)11-10-12-20(21)17(5)6/h10-13,16-17H,14H2,1-9H3/b23-18+ |
| InChIKey | SWYXSHMZTIMUQN-PTGBLXJZSA-N |
| XLogP | 7.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|