C29H41ClN2 — CID 139133966
N-[(E)-3-chloro-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-2,6-di(propan-2-yl)aniline (PubChem CID 139133966) has the molecular formula C29H41ClN2 and a molecular weight of 453.11 g/mol. Its IUPAC name is N-[(E)-3-chloro-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[(E)-3-chloro-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 139133966 |
| Molecular Formula | C29H41ClN2 |
| Molecular Weight | 453.11 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | N-[(E)-3-chloro-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(=N\c1c(C(C)C)cccc1C(C)C)/C(Cl)=C(/C)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H41ClN2/c1-17(2)23-13-11-14-24(18(3)4)28(23)31-21(9)27(30)22(10)32-29-25(19(5)6)15-12-16-26(29)20(7)8/h11-20,31H,1-10H3/b27-21+,32-22+ |
| InChIKey | CORPNYGXEDLLTJ-HYKQLWBBSA-N |
| XLogP | 9.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.11 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|