C24H29N3 — CID 177497506
(Z)-3-anilino-2-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]but-2-enenitrile (PubChem CID 177497506) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is (Z)-3-anilino-2-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]but-2-enenitrile.
| Compound Name | (Z)-3-anilino-2-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]but-2-enenitrile |
|---|---|
| PubChem CID | 177497506 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | (Z)-3-anilino-2-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]but-2-enenitrile |
| SMILES | C/C(Nc1ccccc1)=C(C#N)\C(C)=N\c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C24H29N3/c1-16(2)21-13-10-14-22(17(3)4)24(21)27-19(6)23(15-25)18(5)26-20-11-8-7-9-12-20/h7-14,16-17,26H,1-6H3/b23-18+,27-19+ |
| InChIKey | OOTGSPJILRJGQC-JVUNWXEUSA-N |
| XLogP | 6.94 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|