C28H39N2- — CID 23523221
[2,6-di(propan-2-yl)phenyl]-[3-[2,6-di(propan-2-yl)phenyl]iminobut-1-en-2-yl]azanide (PubChem CID 23523221) has the molecular formula C28H39N2- and a molecular weight of 403.63 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-[3-[2,6-di(propan-2-yl)phenyl]iminobut-1-en-2-yl]azanide.
| Compound Name | [2,6-di(propan-2-yl)phenyl]-[3-[2,6-di(propan-2-yl)phenyl]iminobut-1-en-2-yl]azanide |
|---|---|
| PubChem CID | 23523221 |
| Molecular Formula | C28H39N2- |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-[3-[2,6-di(propan-2-yl)phenyl]iminobut-1-en-2-yl]azanide |
| SMILES | C=C([N-]c1c(C(C)C)cccc1C(C)C)/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H39N2/c1-17(2)23-13-11-14-24(18(3)4)27(23)29-21(9)22(10)30-28-25(19(5)6)15-12-16-26(28)20(7)8/h11-20H,9H2,1-8,10H3/q-1/b30-22+ |
| InChIKey | QBNGVWCSBITSFK-JBASAIQMSA-N |
| XLogP | 9.49 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|