C31H48N3- — CID 102382050
[2,6-di(propan-2-yl)phenyl]-[N'-[2,6-di(propan-2-yl)phenyl]-N,N-di(propan-2-yl)carbamimidoyl]azanide (PubChem CID 102382050) has the molecular formula C31H48N3- and a molecular weight of 462.75 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-[N'-[2,6-di(propan-2-yl)phenyl]-N,N-di(propan-2-yl)carbamimidoyl]azanide.
| Compound Name | [2,6-di(propan-2-yl)phenyl]-[N'-[2,6-di(propan-2-yl)phenyl]-N,N-di(propan-2-yl)carbamimidoyl]azanide |
|---|---|
| PubChem CID | 102382050 |
| Molecular Formula | C31H48N3- |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-[N'-[2,6-di(propan-2-yl)phenyl]-N,N-di(propan-2-yl)carbamimidoyl]azanide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\[N-]c1c(C(C)C)cccc1C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C31H48N3/c1-19(2)25-15-13-16-26(20(3)4)29(25)32-31(34(23(9)10)24(11)12)33-30-27(21(5)6)17-14-18-28(30)22(7)8/h13-24H,1-12H3/q-1 |
| InChIKey | CALKFHQOBCBQRB-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|