C47H71FeN3 — CID 139130265
[2,6-di(propan-2-yl)phenyl]azanide;[2,6-di(propan-2-yl)phenyl]-[(Z)-5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]azanide;iron(2+) (PubChem CID 139130265) has the molecular formula C47H71FeN3 and a molecular weight of 733.95 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]azanide;[2,6-di(propan-2-yl)phenyl]-[(Z)-5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]azanide;iron(2+).
| Compound Name | [2,6-di(propan-2-yl)phenyl]azanide;[2,6-di(propan-2-yl)phenyl]-[(Z)-5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]azanide;iron(2+) |
|---|---|
| PubChem CID | 139130265 |
| Molecular Formula | C47H71FeN3 |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.50 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]azanide;[2,6-di(propan-2-yl)phenyl]-[(Z)-5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]azanide;iron(2+) |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/C=C(\[N-]c1c(C(C)C)cccc1C(C)C)C(C)(C)C)C(C)(C)C.CC(C)c1cccc(C(C)C)c1[NH-].[Fe+2] |
| InChI | InChI=1S/C35H53N2.C12H18N.Fe/c1-22(2)26-17-15-18-27(23(3)4)32(26)36-30(34(9,10)11)21-31(35(12,13)14)37-33-28(24(5)6)19-16-20-29(33)25(7)8;1-8(2)10-6-5-7-11(9(3)4)12(10)13;/h15-25H,1-14H3;5-9,13H,1-4H3;/q2*-1;+2/b30-21-,37-31-;; |
| InChIKey | LRTYGULZYPVEEP-WOSDKRSLSA-N |
| XLogP | 16.55 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|