C35H54N2 — CID 72959562
N-[5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]-2,6-di(propan-2-yl)aniline (PubChem CID 72959562) has the molecular formula C35H54N2 and a molecular weight of 502.83 g/mol. Its IUPAC name is N-[5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 72959562 |
| Molecular Formula | C35H54N2 |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.43 |
| IUPAC Name | N-[5-[2,6-di(propan-2-yl)phenyl]imino-2,2,6,6-tetramethylhept-3-en-3-yl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/C=C(Nc1c(C(C)C)cccc1C(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C35H54N2/c1-22(2)26-17-15-18-27(23(3)4)32(26)36-30(34(9,10)11)21-31(35(12,13)14)37-33-28(24(5)6)19-16-20-29(33)25(7)8/h15-25,36H,1-14H3/b30-21?,37-31- |
| InChIKey | MDNGJUJMYSJZML-WLJQPICRSA-N |
| XLogP | 11.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|