C29H36F6N2 — CID 12074470
N-[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-2,6-di(propan-2-yl)aniline (PubChem CID 12074470) has the molecular formula C29H36F6N2 and a molecular weight of 526.61 g/mol. Its IUPAC name is N-[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 12074470 |
| Molecular Formula | C29H36F6N2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N-[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/C=C(\Nc1c(C(C)C)cccc1C(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H36F6N2/c1-16(2)20-11-9-12-21(17(3)4)26(20)36-24(28(30,31)32)15-25(29(33,34)35)37-27-22(18(5)6)13-10-14-23(27)19(7)8/h9-19,36H,1-8H3/b24-15-,37-25- |
| InChIKey | JWCXATSVJRZNEL-JAHOJVMCSA-N |
| XLogP | 10.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|