C38H47CuF6N2 — CID 162414801
benzene;copper(1+);[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-[2,4,6-tri(propan-2-yl)phenyl]azanide (PubChem CID 162414801) has the molecular formula C38H47CuF6N2 and a molecular weight of 709.34 g/mol. Its IUPAC name is benzene;copper(1+);[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-[2,4,6-tri(propan-2-yl)phenyl]azanide.
| Compound Name | benzene;copper(1+);[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-[2,4,6-tri(propan-2-yl)phenyl]azanide |
|---|---|
| PubChem CID | 162414801 |
| Molecular Formula | C38H47CuF6N2 |
| Molecular Weight | 709.34 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | benzene;copper(1+);[(Z)-4-[2,6-di(propan-2-yl)phenyl]imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-[2,4,6-tri(propan-2-yl)phenyl]azanide |
| SMILES | CC(C)c1cc(C(C)C)c([N-]/C(=C\C(=N\c2c(C(C)C)cccc2C(C)C)C(F)(F)F)C(F)(F)F)c(C(C)C)c1.[Cu+].c1ccccc1 |
| InChI | InChI=1S/C32H41F6N2.C6H6.Cu/c1-17(2)22-14-25(20(7)8)30(26(15-22)21(9)10)40-28(32(36,37)38)16-27(31(33,34)35)39-29-23(18(3)4)12-11-13-24(29)19(5)6;1-2-4-6-5-3-1;/h11-21H,1-10H3;1-6H;/q-1;;+1/b28-16-,39-27-;; |
| InChIKey | DFUJUCQOXFMIKJ-GRDOMTGLSA-N |
| XLogP | 13.77 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.34 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|