C23H22CuF6N3 — CID 139126707
acetonitrile;copper(1+);(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]azanide (PubChem CID 139126707) has the molecular formula C23H22CuF6N3 and a molecular weight of 517.98 g/mol. Its IUPAC name is acetonitrile;copper(1+);(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]azanide.
| Compound Name | acetonitrile;copper(1+);(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]azanide |
|---|---|
| PubChem CID | 139126707 |
| Molecular Formula | C23H22CuF6N3 |
| Molecular Weight | 517.98 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | acetonitrile;copper(1+);(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)imino-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]azanide |
| SMILES | CC#N.Cc1cccc(C)c1/N=C(/C=C(\[N-]c1c(C)cccc1C)C(F)(F)F)C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C21H19F6N2.C2H3N.Cu/c1-12-7-5-8-13(2)18(12)28-16(20(22,23)24)11-17(21(25,26)27)29-19-14(3)9-6-10-15(19)4;1-2-3;/h5-11H,1-4H3;1H3;/q-1;;+1/b16-11-,29-17-;; |
| InChIKey | MXYCAQOIERLNBO-UPAAENSPSA-N |
| XLogP | 8.23 |
| TPSA | 50.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.98 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|