C37H37N2P — CID 132582428
N-(2-diphenylphosphanylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]benzenecarboximidamide (PubChem CID 132582428) has the molecular formula C37H37N2P and a molecular weight of 540.69 g/mol. Its IUPAC name is N-(2-diphenylphosphanylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]benzenecarboximidamide.
| Compound Name | N-(2-diphenylphosphanylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 132582428 |
| Molecular Formula | C37H37N2P |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | N-(2-diphenylphosphanylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]benzenecarboximidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/Nc1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H37N2P/c1-27(2)32-23-16-24-33(28(3)4)36(32)39-37(29-17-8-5-9-18-29)38-34-25-14-15-26-35(34)40(30-19-10-6-11-20-30)31-21-12-7-13-22-31/h5-28H,1-4H3,(H,38,39) |
| InChIKey | UJTYXBVVVKSWOP-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|