C30H30N3PS — CID 177451514
(3E)-3-[(2-diphenylphosphanylanilino)-phenylmethylidene]-1,1-diethylthiourea (PubChem CID 177451514) has the molecular formula C30H30N3PS and a molecular weight of 495.63 g/mol. Its IUPAC name is (3E)-3-[(2-diphenylphosphanylanilino)-phenylmethylidene]-1,1-diethylthiourea.
| Compound Name | (3E)-3-[(2-diphenylphosphanylanilino)-phenylmethylidene]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 177451514 |
| Molecular Formula | C30H30N3PS |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (3E)-3-[(2-diphenylphosphanylanilino)-phenylmethylidene]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)/N=C(/Nc1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N3PS/c1-3-33(4-2)30(35)32-29(24-16-8-5-9-17-24)31-27-22-14-15-23-28(27)34(25-18-10-6-11-19-25)26-20-12-7-13-21-26/h5-23H,3-4H2,1-2H3,(H,31,32,35) |
| InChIKey | DHRRIEUAAQVBMV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|