C22H32NPSi — CID 134934193
(E)-1-diphenylphosphanyl-N,N-diethyl-2-trimethylsilylprop-1-en-1-amine (PubChem CID 134934193) has the molecular formula C22H32NPSi and a molecular weight of 369.56 g/mol. Its IUPAC name is (E)-1-diphenylphosphanyl-N,N-diethyl-2-trimethylsilylprop-1-en-1-amine.
| Compound Name | (E)-1-diphenylphosphanyl-N,N-diethyl-2-trimethylsilylprop-1-en-1-amine |
|---|---|
| PubChem CID | 134934193 |
| Molecular Formula | C22H32NPSi |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (E)-1-diphenylphosphanyl-N,N-diethyl-2-trimethylsilylprop-1-en-1-amine |
| SMILES | CCN(CC)/C(=C(/C)[Si](C)(C)C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32NPSi/c1-7-23(8-2)22(19(3)25(4,5)6)24(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18H,7-8H2,1-6H3/b22-19+ |
| InChIKey | AAGYYGGWROTSJN-ZBJSNUHESA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|