C15H18N2O4 — CID 11277720
[(Z)-[1-(diethylamino)-1,3-dioxobutan-2-ylidene]amino] benzoate (PubChem CID 11277720) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(Z)-[1-(diethylamino)-1,3-dioxobutan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-(diethylamino)-1,3-dioxobutan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 11277720 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(Z)-[1-(diethylamino)-1,3-dioxobutan-2-ylidene]amino] benzoate |
| SMILES | CCN(CC)C(=O)/C(=N\OC(=O)c1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H18N2O4/c1-4-17(5-2)14(19)13(11(3)18)16-21-15(20)12-9-7-6-8-10-12/h6-10H,4-5H2,1-3H3/b16-13- |
| InChIKey | ZNQFTKGOABRFFL-SSZFMOIBSA-N |
| XLogP | 1.66 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|