C18H27NOSSi — CID 102083408
(E)-N,N-diethyl-3-methyl-4-oxo-4-phenyl-2-trimethylsilylbut-2-enethioamide (PubChem CID 102083408) has the molecular formula C18H27NOSSi and a molecular weight of 333.57 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-methyl-4-oxo-4-phenyl-2-trimethylsilylbut-2-enethioamide.
| Compound Name | (E)-N,N-diethyl-3-methyl-4-oxo-4-phenyl-2-trimethylsilylbut-2-enethioamide |
|---|---|
| PubChem CID | 102083408 |
| Molecular Formula | C18H27NOSSi |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (E)-N,N-diethyl-3-methyl-4-oxo-4-phenyl-2-trimethylsilylbut-2-enethioamide |
| SMILES | CCN(CC)C(=S)/C(=C(/C)C(=O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H27NOSSi/c1-7-19(8-2)18(21)17(22(4,5)6)14(3)16(20)15-12-10-9-11-13-15/h9-13H,7-8H2,1-6H3/b17-14+ |
| InChIKey | XOJOPSUSIZKIBN-SAPNQHFASA-N |
| XLogP | 4.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|