C13H17N3O2S — CID 173131051
[diethylamino(phenyl)methylidene]carbamothioylcarbamic acid (PubChem CID 173131051) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is [diethylamino(phenyl)methylidene]carbamothioylcarbamic acid.
| Compound Name | [diethylamino(phenyl)methylidene]carbamothioylcarbamic acid |
|---|---|
| PubChem CID | 173131051 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [diethylamino(phenyl)methylidene]carbamothioylcarbamic acid |
| SMILES | CCN(CC)C(=NC(=S)NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-16(4-2)11(10-8-6-5-7-9-10)14-12(19)15-13(17)18/h5-9H,3-4H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | KJWJPIOWVSPOCB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|