C34H38N4O2S — CID 58753464
N'-[4-[4-[[diethylamino(phenyl)methylidene]amino]phenyl]sulfonylphenyl]-N,N-diethylbenzenecarboximidamide (PubChem CID 58753464) has the molecular formula C34H38N4O2S and a molecular weight of 566.77 g/mol. Its IUPAC name is N'-[4-[4-[[diethylamino(phenyl)methylidene]amino]phenyl]sulfonylphenyl]-N,N-diethylbenzenecarboximidamide.
| Compound Name | N'-[4-[4-[[diethylamino(phenyl)methylidene]amino]phenyl]sulfonylphenyl]-N,N-diethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 58753464 |
| Molecular Formula | C34H38N4O2S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | N'-[4-[4-[[diethylamino(phenyl)methylidene]amino]phenyl]sulfonylphenyl]-N,N-diethylbenzenecarboximidamide |
| SMILES | CCN(CC)/C(=N\c1ccc(S(=O)(=O)c2ccc(/N=C(/c3ccccc3)N(CC)CC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N4O2S/c1-5-37(6-2)33(27-15-11-9-12-16-27)35-29-19-23-31(24-20-29)41(39,40)32-25-21-30(22-26-32)36-34(38(7-3)8-4)28-17-13-10-14-18-28/h9-26H,5-8H2,1-4H3/b35-33-,36-34- |
| InChIKey | NCJFVMUDPJJHJV-SGRXOXICSA-N |
| XLogP | 7.36 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|