C22H30N2O2S — CID 4271791
N'-(5-tert-butyl-2-methylphenyl)sulfonyl-N,N-diethylbenzenecarboximidamide (PubChem CID 4271791) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is N'-(5-tert-butyl-2-methylphenyl)sulfonyl-N,N-diethylbenzenecarboximidamide.
| Compound Name | N'-(5-tert-butyl-2-methylphenyl)sulfonyl-N,N-diethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 4271791 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N'-(5-tert-butyl-2-methylphenyl)sulfonyl-N,N-diethylbenzenecarboximidamide |
| SMILES | CCN(CC)C(=NS(=O)(=O)c1cc(C(C)(C)C)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O2S/c1-7-24(8-2)21(18-12-10-9-11-13-18)23-27(25,26)20-16-19(22(4,5)6)15-14-17(20)3/h9-16H,7-8H2,1-6H3 |
| InChIKey | OLHVLLSHRGIFOD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|