C18H20N2OS — CID 88666672
2-(N,N-diethyl-N'-phenylcarbamimidoyl)benzenecarbothioic S-acid (PubChem CID 88666672) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-(N,N-diethyl-N'-phenylcarbamimidoyl)benzenecarbothioic S-acid.
| Compound Name | 2-(N,N-diethyl-N'-phenylcarbamimidoyl)benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 88666672 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-(N,N-diethyl-N'-phenylcarbamimidoyl)benzenecarbothioic S-acid |
| SMILES | CCN(CC)/C(=N\c1ccccc1)c1ccccc1C(=O)S |
| InChI | InChI=1S/C18H20N2OS/c1-3-20(4-2)17(19-14-10-6-5-7-11-14)15-12-8-9-13-16(15)18(21)22/h5-13H,3-4H2,1-2H3,(H,21,22)/b19-17- |
| InChIKey | VWZCPEFXKSULJQ-ZPHPHTNESA-N |
| XLogP | 4.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|