About 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid
2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid (PubChem CID 88667639) has the molecular formula C13H18N2S2
and a molecular weight of 266.44 g/mol. Its IUPAC name is 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid.
Molecular Properties
| Compound Name | 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid |
| PubChem CID | 88667639 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid |
| SMILES | CCN(CC)/C(=N\C)c1ccccc1C(=S)S |
| InChI | InChI=1S/C13H18N2S2/c1-4-15(5-2)12(14-3)10-8-6-7-9-11(10)13(16)17/h6-9H,4-5H2,1-3H3,(H,16,17)/b14-12- |
| InChIKey | CUEJPVRAGUQGMR-OWBHPGMISA-N |
| XLogP | 3.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid?
The IUPAC name of 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid (CID 88667639) is 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid.
What is the SMILES notation for 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid?
The canonical SMILES for 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid is CCN(CC)/C(=N\C)c1ccccc1C(=S)S.
What is the InChIKey of 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid?
The InChIKey is CUEJPVRAGUQGMR-OWBHPGMISA-N. The full InChI is InChI=1S/C13H18N2S2/c1-4-15(5-2)12(14-3)10-8-6-7-9-11(10)13(16)17/h6-9H,4-5H2,1-3H3,(H,16,17)/b14-12-.
What are the key properties of 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid?
2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid has a molecular weight of 266.44 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N,N-diethyl-N'-methylcarbamimidoyl)benzenecarbodithioic acid is sourced from PubChem (CID 88667639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).