C14H24N2O — CID 143076718
2-hydroxy-N,N,N',3-tetramethylbenzenecarboximidamide;propane (PubChem CID 143076718) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-hydroxy-N,N,N',3-tetramethylbenzenecarboximidamide;propane.
| Compound Name | 2-hydroxy-N,N,N',3-tetramethylbenzenecarboximidamide;propane |
|---|---|
| PubChem CID | 143076718 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-hydroxy-N,N,N',3-tetramethylbenzenecarboximidamide;propane |
| SMILES | C/N=C(/c1cccc(C)c1O)N(C)C.CCC |
| InChI | InChI=1S/C11H16N2O.C3H8/c1-8-6-5-7-9(10(8)14)11(12-2)13(3)4;1-3-2/h5-7,14H,1-4H3;3H2,1-2H3/b12-11-; |
| InChIKey | RXTYWVYFUHUDAD-AFEZEDKISA-N |
| XLogP | 3.05 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|